About 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one
8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 10798628) has the molecular formula C10H9F2NO2
and a molecular weight of 213.18 g/mol. Its IUPAC name is 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 10798628 |
| Molecular Formula | C10H9F2NO2 |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | Nc1cc(F)c(F)c2c1C(=O)CCC2O |
| InChI | InChI=1S/C10H9F2NO2/c11-4-3-5(13)8-6(14)1-2-7(15)9(8)10(4)12/h3,7,15H,1-2,13H2 |
| InChIKey | VBAGNWOFNGBISE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one (CID 10798628) is 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one is Nc1cc(F)c(F)c2c1C(=O)CCC2O.
What is the InChIKey of 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is VBAGNWOFNGBISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2NO2/c11-4-3-5(13)8-6(14)1-2-7(15)9(8)10(4)12/h3,7,15H,1-2,13H2.
What are the key properties of 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one?
8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 213.18 g/mol, XLogP of 1.56, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-5,6-difluoro-4-hydroxy-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 10798628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).