About 2-pentyl-4-phenylfuran
2-pentyl-4-phenylfuran (PubChem CID 10798694) has the molecular formula C15H18O
and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-pentyl-4-phenylfuran.
Molecular Properties
| Compound Name | 2-pentyl-4-phenylfuran |
| PubChem CID | 10798694 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-pentyl-4-phenylfuran |
| SMILES | CCCCCc1cc(-c2ccccc2)co1 |
| InChI | InChI=1S/C15H18O/c1-2-3-5-10-15-11-14(12-16-15)13-8-6-4-7-9-13/h4,6-9,11-12H,2-3,5,10H2,1H3 |
| InChIKey | VXGBEJOEDJDRSY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-4-phenylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-4-phenylfuran?
The IUPAC name of 2-pentyl-4-phenylfuran (CID 10798694) is 2-pentyl-4-phenylfuran.
What is the SMILES notation for 2-pentyl-4-phenylfuran?
The canonical SMILES for 2-pentyl-4-phenylfuran is CCCCCc1cc(-c2ccccc2)co1.
What is the InChIKey of 2-pentyl-4-phenylfuran?
The InChIKey is VXGBEJOEDJDRSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O/c1-2-3-5-10-15-11-14(12-16-15)13-8-6-4-7-9-13/h4,6-9,11-12H,2-3,5,10H2,1H3.
What are the key properties of 2-pentyl-4-phenylfuran?
2-pentyl-4-phenylfuran has a molecular weight of 214.31 g/mol, XLogP of 4.68, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-4-phenylfuran is sourced from PubChem (CID 10798694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).