About (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one
(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one (PubChem CID 10798844) has the molecular formula C9H14O6
and a molecular weight of 218.20 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one.
Molecular Properties
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one |
| PubChem CID | 10798844 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one |
| SMILES | CCCOC1=C(O)C(=O)O[C@@H]1[C@@H](O)CO |
| InChI | InChI=1S/C9H14O6/c1-2-3-14-8-6(12)9(13)15-7(8)5(11)4-10/h5,7,10-12H,2-4H2,1H3/t5-,7+/m0/s1 |
| InChIKey | VNCOLRBYIYYPBZ-CAHLUQPWSA-N |
| XLogP | -0.54 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one?
The IUPAC name of (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one (CID 10798844) is (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one.
What is the SMILES notation for (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one?
The canonical SMILES for (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one is CCCOC1=C(O)C(=O)O[C@@H]1[C@@H](O)CO.
What is the InChIKey of (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one?
The InChIKey is VNCOLRBYIYYPBZ-CAHLUQPWSA-N. The full InChI is InChI=1S/C9H14O6/c1-2-3-14-8-6(12)9(13)15-7(8)5(11)4-10/h5,7,10-12H,2-4H2,1H3/t5-,7+/m0/s1.
What are the key properties of (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one?
(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one has a molecular weight of 218.20 g/mol, XLogP of -0.54, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-3-propoxy-2H-furan-5-one is sourced from PubChem (CID 10798844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).