About N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide
N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide (PubChem CID 10798920) has the molecular formula C12H13NOS
and a molecular weight of 219.31 g/mol. Its IUPAC name is N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide |
| PubChem CID | 10798920 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide |
| SMILES | C=C(NC(C)=O)C(=C)Sc1ccccc1 |
| InChI | InChI=1S/C12H13NOS/c1-9(13-11(3)14)10(2)15-12-7-5-4-6-8-12/h4-8H,1-2H2,3H3,(H,13,14) |
| InChIKey | QJWYMVJOSDUMAU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide?
The IUPAC name of N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide (CID 10798920) is N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide.
What is the SMILES notation for N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide?
The canonical SMILES for N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide is C=C(NC(C)=O)C(=C)Sc1ccccc1.
What is the InChIKey of N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide?
The InChIKey is QJWYMVJOSDUMAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NOS/c1-9(13-11(3)14)10(2)15-12-7-5-4-6-8-12/h4-8H,1-2H2,3H3,(H,13,14).
What are the key properties of N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide?
N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide has a molecular weight of 219.31 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-phenylsulfanylbuta-1,3-dien-2-yl)acetamide is sourced from PubChem (CID 10798920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).