C13H13N3O2 — CID 107989836
N-[4-(2-oxoimidazolidin-1-yl)phenyl]but-2-ynamide (PubChem CID 107989836) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is N-[4-(2-oxoimidazolidin-1-yl)phenyl]but-2-ynamide.
| Compound Name | N-[4-(2-oxoimidazolidin-1-yl)phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 107989836 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-[4-(2-oxoimidazolidin-1-yl)phenyl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1ccc(N2CCNC2=O)cc1 |
| InChI | InChI=1S/C13H13N3O2/c1-2-3-12(17)15-10-4-6-11(7-5-10)16-9-8-14-13(16)18/h4-7H,8-9H2,1H3,(H,14,18)(H,15,17) |
| InChIKey | ZSQCYTBWBOBFQE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|