About 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione
4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione (PubChem CID 107989921) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione.
Molecular Properties
| Compound Name | 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione |
| PubChem CID | 107989921 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC#CC(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C10H12N2O3/c1-4-5-8(14)12-6-7(13)11-9(15)10(12,2)3/h6H2,1-3H3,(H,11,13,15) |
| InChIKey | MTMKKABRHPBEDH-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione?
The IUPAC name of 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione (CID 107989921) is 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione.
What is the SMILES notation for 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione?
The canonical SMILES for 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione is CC#CC(=O)N1CC(=O)NC(=O)C1(C)C.
What is the InChIKey of 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione?
The InChIKey is MTMKKABRHPBEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3/c1-4-5-8(14)12-6-7(13)11-9(15)10(12,2)3/h6H2,1-3H3,(H,11,13,15).
What are the key properties of 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione?
4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione has a molecular weight of 208.22 g/mol, XLogP of -0.73, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione is sourced from PubChem (CID 107989921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).