C10H12N2O3 — CID 107989921
4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione (PubChem CID 107989921) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 107989921 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-but-2-ynoyl-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC#CC(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C10H12N2O3/c1-4-5-8(14)12-6-7(13)11-9(15)10(12,2)3/h6H2,1-3H3,(H,11,13,15) |
| InChIKey | MTMKKABRHPBEDH-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|