About (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine
(3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine (PubChem CID 10799) has the molecular formula C12H21AsN2O5
and a molecular weight of 348.23 g/mol. Its IUPAC name is (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine.
Molecular Properties
| Compound Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine |
| PubChem CID | 10799 |
| Molecular Formula | C12H21AsN2O5 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine |
| SMILES | CC(=O)Nc1cc([As](=O)(O)O)ccc1O.CCNCC |
| InChI | InChI=1S/C8H10AsNO5.C4H11N/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12;1-3-5-4-2/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);5H,3-4H2,1-2H3 |
| InChIKey | STEOHWLXOZVVIU-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine?
The IUPAC name of (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine (CID 10799) is (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine.
What is the SMILES notation for (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine?
The canonical SMILES for (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine is CC(=O)Nc1cc([As](=O)(O)O)ccc1O.CCNCC.
What is the InChIKey of (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine?
The InChIKey is STEOHWLXOZVVIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10AsNO5.C4H11N/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12;1-3-5-4-2/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);5H,3-4H2,1-2H3.
What are the key properties of (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine?
(3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine has a molecular weight of 348.23 g/mol, XLogP of -0.47, 4 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetamido-4-hydroxyphenyl)arsonic acid;N-ethylethanamine is sourced from PubChem (CID 10799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).