C13H17BrClN3O — CID 107990091
3-bromo-4-chloro-N-(2-piperazin-1-ylethyl)benzamide (PubChem CID 107990091) has the molecular formula C13H17BrClN3O and a molecular weight of 346.66 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-(2-piperazin-1-ylethyl)benzamide.
| Compound Name | 3-bromo-4-chloro-N-(2-piperazin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 107990091 |
| Molecular Formula | C13H17BrClN3O |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 3-bromo-4-chloro-N-(2-piperazin-1-ylethyl)benzamide |
| SMILES | O=C(NCCN1CCNCC1)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H17BrClN3O/c14-11-9-10(1-2-12(11)15)13(19)17-5-8-18-6-3-16-4-7-18/h1-2,9,16H,3-8H2,(H,17,19) |
| InChIKey | FTMWATOXFCWHTG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |