C13H18O3 — CID 10799059
(4aR,7E,11aS)-7-methyl-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3,11-dione (PubChem CID 10799059) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (4aR,7E,11aS)-7-methyl-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3,11-dione.
| Compound Name | (4aR,7E,11aS)-7-methyl-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3,11-dione |
|---|---|
| PubChem CID | 10799059 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (4aR,7E,11aS)-7-methyl-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3,11-dione |
| SMILES | C/C1=C\CCC(=O)[C@@H]2COC(=O)C[C@H]2CC1 |
| InChI | InChI=1S/C13H18O3/c1-9-3-2-4-12(14)11-8-16-13(15)7-10(11)6-5-9/h3,10-11H,2,4-8H2,1H3/b9-3+/t10-,11-/m1/s1 |
| InChIKey | AGWOSTFYNXIHED-VIXUHMKYSA-N |
| XLogP | 2.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|