C10H16N4S — CID 10799188
2-[3-(4,5-dihydro-1H-imidazol-5-yl)propylsulfanyl]-1-methylimidazole (PubChem CID 10799188) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-[3-(4,5-dihydro-1H-imidazol-5-yl)propylsulfanyl]-1-methylimidazole.
| Compound Name | 2-[3-(4,5-dihydro-1H-imidazol-5-yl)propylsulfanyl]-1-methylimidazole |
|---|---|
| PubChem CID | 10799188 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-[3-(4,5-dihydro-1H-imidazol-5-yl)propylsulfanyl]-1-methylimidazole |
| SMILES | Cn1ccnc1SCCCC1CN=CN1 |
| InChI | InChI=1S/C10H16N4S/c1-14-5-4-12-10(14)15-6-2-3-9-7-11-8-13-9/h4-5,8-9H,2-3,6-7H2,1H3,(H,11,13) |
| InChIKey | REJIPKCLLVPSSF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|