C14H11ClFN3O2 — CID 107992341
4-chloro-3-fluoro-N-[2-[(E)-N'-hydroxycarbamimidoyl]phenyl]benzamide (PubChem CID 107992341) has the molecular formula C14H11ClFN3O2 and a molecular weight of 307.71 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-[2-[(E)-N'-hydroxycarbamimidoyl]phenyl]benzamide.
| Compound Name | 4-chloro-3-fluoro-N-[2-[(E)-N'-hydroxycarbamimidoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 107992341 |
| Molecular Formula | C14H11ClFN3O2 |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-chloro-3-fluoro-N-[2-[(E)-N'-hydroxycarbamimidoyl]phenyl]benzamide |
| SMILES | N/C(=N/O)c1ccccc1NC(=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H11ClFN3O2/c15-10-6-5-8(7-11(10)16)14(20)18-12-4-2-1-3-9(12)13(17)19-21/h1-7,21H,(H2,17,19)(H,18,20) |
| InChIKey | UEKJRUHQEUFWCM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|