C10H18N4O2 — CID 10799267
1,4,7,10-tetrazabicyclo[8.2.2]tetradecane-11,12-dione (PubChem CID 10799267) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1,4,7,10-tetrazabicyclo[8.2.2]tetradecane-11,12-dione.
| Compound Name | 1,4,7,10-tetrazabicyclo[8.2.2]tetradecane-11,12-dione |
|---|---|
| PubChem CID | 10799267 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1,4,7,10-tetrazabicyclo[8.2.2]tetradecane-11,12-dione |
| SMILES | O=C1C(=O)N2CCNCCNCCN1CC2 |
| InChI | InChI=1S/C10H18N4O2/c15-9-10(16)14-6-4-12-2-1-11-3-5-13(9)7-8-14/h11-12H,1-8H2 |
| InChIKey | AMVQWNQETPVABI-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|