C13H26OSi — CID 10799291
(1R,2S,5R)-5-methyl-2-(3-trimethylsilylprop-1-en-2-yl)cyclohexan-1-ol (PubChem CID 10799291) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is (1R,2S,5R)-5-methyl-2-(3-trimethylsilylprop-1-en-2-yl)cyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-5-methyl-2-(3-trimethylsilylprop-1-en-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10799291 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (1R,2S,5R)-5-methyl-2-(3-trimethylsilylprop-1-en-2-yl)cyclohexan-1-ol |
| SMILES | C=C(C[Si](C)(C)C)[C@@H]1CC[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C13H26OSi/c1-10-6-7-12(13(14)8-10)11(2)9-15(3,4)5/h10,12-14H,2,6-9H2,1,3-5H3/t10-,12+,13-/m1/s1 |
| InChIKey | HUHNLLDSORWORZ-KGYLQXTDSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|