C10H13BrClNO — CID 107994199
1-(2-bromo-4-chlorophenyl)-2-ethoxyethanamine (PubChem CID 107994199) has the molecular formula C10H13BrClNO and a molecular weight of 278.58 g/mol. Its IUPAC name is 1-(2-bromo-4-chlorophenyl)-2-ethoxyethanamine.
| Compound Name | 1-(2-bromo-4-chlorophenyl)-2-ethoxyethanamine |
|---|---|
| PubChem CID | 107994199 |
| Molecular Formula | C10H13BrClNO |
| Molecular Weight | 278.58 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 1-(2-bromo-4-chlorophenyl)-2-ethoxyethanamine |
| SMILES | CCOCC(N)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C10H13BrClNO/c1-2-14-6-10(13)8-4-3-7(12)5-9(8)11/h3-5,10H,2,6,13H2,1H3 |
| InChIKey | UOTYHENJQQDXBV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |