C12H15N5 — CID 10799430
2-(1H-1,2,4-triazol-5-ylmethyl)-3,4-dihydro-1H-isoquinolin-6-amine (PubChem CID 10799430) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-ylmethyl)-3,4-dihydro-1H-isoquinolin-6-amine.
| Compound Name | 2-(1H-1,2,4-triazol-5-ylmethyl)-3,4-dihydro-1H-isoquinolin-6-amine |
|---|---|
| PubChem CID | 10799430 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-ylmethyl)-3,4-dihydro-1H-isoquinolin-6-amine |
| SMILES | Nc1ccc2c(c1)CCN(Cc1ncn[nH]1)C2 |
| InChI | InChI=1S/C12H15N5/c13-11-2-1-10-6-17(4-3-9(10)5-11)7-12-14-8-15-16-12/h1-2,5,8H,3-4,6-7,13H2,(H,14,15,16) |
| InChIKey | DGNMALJXEGQNKL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|