C12H14ClFINO — CID 107994502
4-chloro-3-fluoro-N-(1-iodo-3-methylbutan-2-yl)benzamide (PubChem CID 107994502) has the molecular formula C12H14ClFINO and a molecular weight of 369.61 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-(1-iodo-3-methylbutan-2-yl)benzamide.
| Compound Name | 4-chloro-3-fluoro-N-(1-iodo-3-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 107994502 |
| Molecular Formula | C12H14ClFINO |
| Molecular Weight | 369.61 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 4-chloro-3-fluoro-N-(1-iodo-3-methylbutan-2-yl)benzamide |
| SMILES | CC(C)C(CI)NC(=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H14ClFINO/c1-7(2)11(6-15)16-12(17)8-3-4-9(13)10(14)5-8/h3-5,7,11H,6H2,1-2H3,(H,16,17) |
| InChIKey | JDTDLYHPYPHWKK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|