C15H13Cl2F2N — CID 107995020
2-(2-chloro-3-fluorophenyl)-1-(4-chloro-3-fluorophenyl)-N-methylethanamine (PubChem CID 107995020) has the molecular formula C15H13Cl2F2N and a molecular weight of 316.18 g/mol. Its IUPAC name is 2-(2-chloro-3-fluorophenyl)-1-(4-chloro-3-fluorophenyl)-N-methylethanamine.
| Compound Name | 2-(2-chloro-3-fluorophenyl)-1-(4-chloro-3-fluorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 107995020 |
| Molecular Formula | C15H13Cl2F2N |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-(2-chloro-3-fluorophenyl)-1-(4-chloro-3-fluorophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1cccc(F)c1Cl)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H13Cl2F2N/c1-20-14(9-5-6-11(16)13(19)7-9)8-10-3-2-4-12(18)15(10)17/h2-7,14,20H,8H2,1H3 |
| InChIKey | JVZOTPZDTIKLFQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |