C14H13BrCl2FNS — CID 107998958
N-[(4-bromo-5-chlorothiophen-2-yl)-(4-chloro-3-fluorophenyl)methyl]propan-1-amine (PubChem CID 107998958) has the molecular formula C14H13BrCl2FNS and a molecular weight of 397.14 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)-(4-chloro-3-fluorophenyl)methyl]propan-1-amine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)-(4-chloro-3-fluorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107998958 |
| Molecular Formula | C14H13BrCl2FNS |
| Molecular Weight | 397.14 g/mol |
| Exact Mass | 394.93 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)-(4-chloro-3-fluorophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(Cl)c(F)c1)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C14H13BrCl2FNS/c1-2-5-19-13(12-7-9(15)14(17)20-12)8-3-4-10(16)11(18)6-8/h3-4,6-7,13,19H,2,5H2,1H3 |
| InChIKey | FEFGHYSSEAKNJS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.14 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |