C12H12BrClN2OS — CID 107999073
N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-3-bromo-4-chlorobenzamide (PubChem CID 107999073) has the molecular formula C12H12BrClN2OS and a molecular weight of 347.67 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-3-bromo-4-chlorobenzamide.
| Compound Name | N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-3-bromo-4-chlorobenzamide |
|---|---|
| PubChem CID | 107999073 |
| Molecular Formula | C12H12BrClN2OS |
| Molecular Weight | 347.67 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | N-(2-amino-1-cyclopropyl-2-sulfanylideneethyl)-3-bromo-4-chlorobenzamide |
| SMILES | NC(=S)C(NC(=O)c1ccc(Cl)c(Br)c1)C1CC1 |
| InChI | InChI=1S/C12H12BrClN2OS/c13-8-5-7(3-4-9(8)14)12(17)16-10(11(15)18)6-1-2-6/h3-6,10H,1-2H2,(H2,15,18)(H,16,17) |
| InChIKey | OFSNVDJUTCJEBS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.67 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|