C13H22N2O2 — CID 10799972
1,3-ditert-butyl-5-methylidene-1,3-diazinane-2,4-dione (PubChem CID 10799972) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-methylidene-1,3-diazinane-2,4-dione.
| Compound Name | 1,3-ditert-butyl-5-methylidene-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 10799972 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1,3-ditert-butyl-5-methylidene-1,3-diazinane-2,4-dione |
| SMILES | C=C1CN(C(C)(C)C)C(=O)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C13H22N2O2/c1-9-8-14(12(2,3)4)11(17)15(10(9)16)13(5,6)7/h1,8H2,2-7H3 |
| InChIKey | XWHDROJVVRXLPC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|