About 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one
2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one (PubChem CID 10800128) has the molecular formula C14H11NO3
and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one.
Molecular Properties
| Compound Name | 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one |
| PubChem CID | 10800128 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1ccccc(-c2cccc(/C=N/O)c2)c1O |
| InChI | InChI=1S/C14H11NO3/c16-13-7-2-1-6-12(14(13)17)11-5-3-4-10(8-11)9-15-18/h1-9,18H,(H,16,17)/b15-9+ |
| InChIKey | ZDLCSWUBRZSXNV-OQLLNIDSSA-N |
| XLogP | 2.23 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one?
The IUPAC name of 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one (CID 10800128) is 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one is O=c1ccccc(-c2cccc(/C=N/O)c2)c1O.
What is the InChIKey of 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one?
The InChIKey is ZDLCSWUBRZSXNV-OQLLNIDSSA-N. The full InChI is InChI=1S/C14H11NO3/c16-13-7-2-1-6-12(14(13)17)11-5-3-4-10(8-11)9-15-18/h1-9,18H,(H,16,17)/b15-9+.
What are the key properties of 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one?
2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one has a molecular weight of 241.25 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-[3-[(E)-hydroxyiminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 10800128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).