C15H14O3 — CID 10800191
(1R,2R,3S,4S,6R,7S,8S,10R)-1-phenyl-9,11,12-trioxapentacyclo[5.4.1.02,6.03,10.04,8]dodecane (PubChem CID 10800191) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is (1R,2R,3S,4S,6R,7S,8S,10R)-1-phenyl-9,11,12-trioxapentacyclo[5.4.1.02,6.03,10.04,8]dodecane.
| Compound Name | (1R,2R,3S,4S,6R,7S,8S,10R)-1-phenyl-9,11,12-trioxapentacyclo[5.4.1.02,6.03,10.04,8]dodecane |
|---|---|
| PubChem CID | 10800191 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (1R,2R,3S,4S,6R,7S,8S,10R)-1-phenyl-9,11,12-trioxapentacyclo[5.4.1.02,6.03,10.04,8]dodecane |
| SMILES | c1ccc([C@@]23O[C@H]4O[C@H]5[C@H]6C[C@@H]([C@@H]5O2)[C@@H]3[C@@H]46)cc1 |
| InChI | InChI=1S/C15H14O3/c1-2-4-7(5-3-1)15-11-9-6-8-10(11)14(18-15)16-12(8)13(9)17-15/h1-5,8-14H,6H2/t8-,9+,10-,11+,12-,13-,14+,15-/m0/s1 |
| InChIKey | CDVPTGVUOCBFPY-BRDKQNBVSA-N |
| XLogP | 1.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |