C8H3F2N3O4 — CID 10800253
6,7-difluoro-5-nitro-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 10800253) has the molecular formula C8H3F2N3O4 and a molecular weight of 243.12 g/mol. Its IUPAC name is 6,7-difluoro-5-nitro-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6,7-difluoro-5-nitro-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10800253 |
| Molecular Formula | C8H3F2N3O4 |
| Molecular Weight | 243.12 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 6,7-difluoro-5-nitro-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc(F)c(F)c([N+](=O)[O-])c2[nH]c1=O |
| InChI | InChI=1S/C8H3F2N3O4/c9-2-1-3-5(6(4(2)10)13(16)17)12-8(15)7(14)11-3/h1H,(H,11,14)(H,12,15) |
| InChIKey | GIUQZJDZWWLXJA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.12 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|