C13H18F2O2 — CID 10800327
4-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-3,3-difluoro-4-hydroxybutan-2-one (PubChem CID 10800327) has the molecular formula C13H18F2O2 and a molecular weight of 244.28 g/mol. Its IUPAC name is 4-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-3,3-difluoro-4-hydroxybutan-2-one.
| Compound Name | 4-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-3,3-difluoro-4-hydroxybutan-2-one |
|---|---|
| PubChem CID | 10800327 |
| Molecular Formula | C13H18F2O2 |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]-3,3-difluoro-4-hydroxybutan-2-one |
| SMILES | CC(=O)C(F)(F)C(O)C1=CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C13H18F2O2/c1-7(16)13(14,15)11(17)9-5-4-8-6-10(9)12(8,2)3/h5,8,10-11,17H,4,6H2,1-3H3/t8-,10-,11?/m0/s1 |
| InChIKey | MNEQQFBWEILKJL-AZXCQMJXSA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|