C11H11F3OS — CID 10800553
[(E)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene (PubChem CID 10800553) has the molecular formula C11H11F3OS and a molecular weight of 248.27 g/mol. Its IUPAC name is [(E)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene.
| Compound Name | [(E)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 10800553 |
| Molecular Formula | C11H11F3OS |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | [(E)-2-ethoxy-3,3,3-trifluoroprop-1-enyl]sulfanylbenzene |
| SMILES | CCO/C(=C/Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3OS/c1-2-15-10(11(12,13)14)8-16-9-6-4-3-5-7-9/h3-8H,2H2,1H3/b10-8+ |
| InChIKey | JOKOZGSCTLVWLX-CSKARUKUSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|