About (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione
(E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione (PubChem CID 10800632) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione.
Molecular Properties
| Compound Name | (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione |
| PubChem CID | 10800632 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione |
| SMILES | C/C=C/CCCCC(=O)C(C)C(=O)N1C=CCC1 |
| InChI | InChI=1S/C15H23NO2/c1-3-4-5-6-7-10-14(17)13(2)15(18)16-11-8-9-12-16/h3-4,8,11,13H,5-7,9-10,12H2,1-2H3/b4-3+ |
| InChIKey | JGNMZTXDOHXIJQ-ONEGZZNKSA-N |
| XLogP | 3.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione?
The IUPAC name of (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione (CID 10800632) is (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione.
What is the SMILES notation for (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione?
The canonical SMILES for (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione is C/C=C/CCCCC(=O)C(C)C(=O)N1C=CCC1.
What is the InChIKey of (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione?
The InChIKey is JGNMZTXDOHXIJQ-ONEGZZNKSA-N. The full InChI is InChI=1S/C15H23NO2/c1-3-4-5-6-7-10-14(17)13(2)15(18)16-11-8-9-12-16/h3-4,8,11,13H,5-7,9-10,12H2,1-2H3/b4-3+.
What are the key properties of (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione?
(E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione has a molecular weight of 249.35 g/mol, XLogP of 3.07, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2,3-dihydropyrrol-1-yl)-2-methyldec-8-ene-1,3-dione is sourced from PubChem (CID 10800632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).