About 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide
2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide (PubChem CID 1080075) has the molecular formula C15H16ClN3O2
and a molecular weight of 305.76 g/mol. Its IUPAC name is 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide.
Molecular Properties
| Compound Name | 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide |
| PubChem CID | 1080075 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide |
| SMILES | Cc1cc(C)n(C(=O)CCNC(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H16ClN3O2/c1-10-9-11(2)19(18-10)14(20)7-8-17-15(21)12-5-3-4-6-13(12)16/h3-6,9H,7-8H2,1-2H3,(H,17,21) |
| InChIKey | PUCRHBPNUMHBNR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide?
The IUPAC name of 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide (CID 1080075) is 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide.
What is the SMILES notation for 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide?
The canonical SMILES for 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide is Cc1cc(C)n(C(=O)CCNC(=O)c2ccccc2Cl)n1.
What is the InChIKey of 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide?
The InChIKey is PUCRHBPNUMHBNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClN3O2/c1-10-9-11(2)19(18-10)14(20)7-8-17-15(21)12-5-3-4-6-13(12)16/h3-6,9H,7-8H2,1-2H3,(H,17,21).
What are the key properties of 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide?
2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide has a molecular weight of 305.76 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)-3-oxopropyl]benzamide is sourced from PubChem (CID 1080075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).