C16H15NO2 — CID 10800861
5-(4-methoxyphenyl)-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 10800861) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3-phenyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-(4-methoxyphenyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 10800861 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 5-(4-methoxyphenyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | COc1ccc(C2CC(c3ccccc3)=NO2)cc1 |
| InChI | InChI=1S/C16H15NO2/c1-18-14-9-7-13(8-10-14)16-11-15(17-19-16)12-5-3-2-4-6-12/h2-10,16H,11H2,1H3 |
| InChIKey | GVKKSHZCCVBTDR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |