2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid

C6H8N2O3S — CID 1080105

IUPAC2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid
SMILESCCc1nnc(SCC(=O)O)o1
InChIInChI=1S/C6H8N2O3S/c1-2-4-7-8-6(11-4)12-3-5(9)10/h2-3H2,1H3,(H,9,10)
InChIKeyGJCMPTMRMSGIAX-UHFFFAOYSA-N
MW188.21 g/mol
LogP0.81
Rot. Bonds4

About 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid

2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid (PubChem CID 1080105) has the molecular formula C6H8N2O3S and a molecular weight of 188.21 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid.

Molecular Properties

Compound Name2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid
PubChem CID1080105
Molecular FormulaC6H8N2O3S
Molecular Weight188.21 g/mol
Exact Mass188.03
IUPAC Name2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid
SMILESCCc1nnc(SCC(=O)O)o1
InChIInChI=1S/C6H8N2O3S/c1-2-4-7-8-6(11-4)12-3-5(9)10/h2-3H2,1H3,(H,9,10)
InChIKeyGJCMPTMRMSGIAX-UHFFFAOYSA-N
XLogP0.81
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.21
LogP ≤ 50.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid?
The IUPAC name of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid (CID 1080105) is 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid.
What is the SMILES notation for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid?
The canonical SMILES for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid is CCc1nnc(SCC(=O)O)o1.
What is the InChIKey of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid?
The InChIKey is GJCMPTMRMSGIAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3S/c1-2-4-7-8-6(11-4)12-3-5(9)10/h2-3H2,1H3,(H,9,10).
What are the key properties of 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid?
2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid has a molecular weight of 188.21 g/mol, XLogP of 0.81, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetic acid is sourced from PubChem (CID 1080105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).