C14H26O4 — CID 10801203
(3S,4R,6S)-3,4-dihydroxy-6-nonyloxan-2-one (PubChem CID 10801203) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (3S,4R,6S)-3,4-dihydroxy-6-nonyloxan-2-one.
| Compound Name | (3S,4R,6S)-3,4-dihydroxy-6-nonyloxan-2-one |
|---|---|
| PubChem CID | 10801203 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (3S,4R,6S)-3,4-dihydroxy-6-nonyloxan-2-one |
| SMILES | CCCCCCCCC[C@H]1C[C@@H](O)[C@H](O)C(=O)O1 |
| InChI | InChI=1S/C14H26O4/c1-2-3-4-5-6-7-8-9-11-10-12(15)13(16)14(17)18-11/h11-13,15-16H,2-10H2,1H3/t11-,12+,13-/m0/s1 |
| InChIKey | MCPAMOWRMOWQKU-XQQFMLRXSA-N |
| XLogP | 2.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|