About (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine
(NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine (PubChem CID 10801290) has the molecular formula C12H15Cl2NO
and a molecular weight of 260.16 g/mol. Its IUPAC name is (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine |
| PubChem CID | 10801290 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine |
| SMILES | O/N=C/CCCCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2NO/c13-11-7-6-10(12(14)9-11)5-3-1-2-4-8-15-16/h6-9,16H,1-5H2/b15-8+ |
| InChIKey | IRMJRMPGLRWCHR-OVCLIPMQSA-N |
| XLogP | 4.56 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine?
The IUPAC name of (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine (CID 10801290) is (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine is O/N=C/CCCCCc1ccc(Cl)cc1Cl.
What is the InChIKey of (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine?
The InChIKey is IRMJRMPGLRWCHR-OVCLIPMQSA-N. The full InChI is InChI=1S/C12H15Cl2NO/c13-11-7-6-10(12(14)9-11)5-3-1-2-4-8-15-16/h6-9,16H,1-5H2/b15-8+.
What are the key properties of (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine?
(NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine has a molecular weight of 260.16 g/mol, XLogP of 4.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[6-(2,4-dichlorophenyl)hexylidene]hydroxylamine is sourced from PubChem (CID 10801290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).