About 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide
5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide (PubChem CID 1080132) has the molecular formula C22H21N3O4
and a molecular weight of 391.43 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide.
Molecular Properties
| Compound Name | 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide |
| PubChem CID | 1080132 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(N3C(=O)C=CC3=O)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H21N3O4/c1-15-2-4-16(5-3-15)23-22(28)18-14-17(25-20(26)8-9-21(25)27)6-7-19(18)24-10-12-29-13-11-24/h2-9,14H,10-13H2,1H3,(H,23,28) |
| InChIKey | QKXCOBBZMYPLCG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide?
The IUPAC name of 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide (CID 1080132) is 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide.
What is the SMILES notation for 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide?
The canonical SMILES for 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide is Cc1ccc(NC(=O)c2cc(N3C(=O)C=CC3=O)ccc2N2CCOCC2)cc1.
What is the InChIKey of 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide?
The InChIKey is QKXCOBBZMYPLCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O4/c1-15-2-4-16(5-3-15)23-22(28)18-14-17(25-20(26)8-9-21(25)27)6-7-19(18)24-10-12-29-13-11-24/h2-9,14H,10-13H2,1H3,(H,23,28).
What are the key properties of 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide?
5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide has a molecular weight of 391.43 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dioxopyrrol-1-yl)-N-(4-methylphenyl)-2-morpholin-4-ylbenzamide is sourced from PubChem (CID 1080132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).