C15H26N4 — CID 10801470
2-(4,5-dihydro-1H-imidazol-2-yl)-1,4-bis(2-methylprop-2-enyl)piperazine (PubChem CID 10801470) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-2-yl)-1,4-bis(2-methylprop-2-enyl)piperazine.
| Compound Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-1,4-bis(2-methylprop-2-enyl)piperazine |
|---|---|
| PubChem CID | 10801470 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-2-yl)-1,4-bis(2-methylprop-2-enyl)piperazine |
| SMILES | C=C(C)CN1CCN(CC(=C)C)C(C2=NCCN2)C1 |
| InChI | InChI=1S/C15H26N4/c1-12(2)9-18-7-8-19(10-13(3)4)14(11-18)15-16-5-6-17-15/h14H,1,3,5-11H2,2,4H3,(H,16,17) |
| InChIKey | XJPMSWZXDJNZFD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|