About N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine
N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine (PubChem CID 10801510) has the molecular formula C17H17N3
and a molecular weight of 263.34 g/mol. Its IUPAC name is N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine.
Molecular Properties
| Compound Name | N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine |
| PubChem CID | 10801510 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine |
| SMILES | Cc1ccc2c(N(C)C)cc(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C17H17N3/c1-12-9-10-14-16(20(2)3)11-15(19-17(14)18-12)13-7-5-4-6-8-13/h4-11H,1-3H3 |
| InChIKey | KZPJKIKUNOEASM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine?
The IUPAC name of N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine (CID 10801510) is N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine.
What is the SMILES notation for N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine?
The canonical SMILES for N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine is Cc1ccc2c(N(C)C)cc(-c3ccccc3)nc2n1.
What is the InChIKey of N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine?
The InChIKey is KZPJKIKUNOEASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3/c1-12-9-10-14-16(20(2)3)11-15(19-17(14)18-12)13-7-5-4-6-8-13/h4-11H,1-3H3.
What are the key properties of N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine?
N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine has a molecular weight of 263.34 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,7-trimethyl-2-phenyl-1,8-naphthyridin-4-amine is sourced from PubChem (CID 10801510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).