C14H18O5 — CID 10801695
(1S,4S,7S)-5,7-diacetyl-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one (PubChem CID 10801695) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (1S,4S,7S)-5,7-diacetyl-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,4S,7S)-5,7-diacetyl-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 10801695 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1S,4S,7S)-5,7-diacetyl-3,3-dimethoxybicyclo[2.2.2]oct-5-en-2-one |
| SMILES | COC1(OC)C(=O)[C@H]2C=C(C(C)=O)[C@@H]1C[C@@H]2C(C)=O |
| InChI | InChI=1S/C14H18O5/c1-7(15)9-6-12-10(8(2)16)5-11(9)13(17)14(12,18-3)19-4/h5,9,11-12H,6H2,1-4H3/t9-,11+,12+/m1/s1 |
| InChIKey | KNQBSEVPHRETIA-USWWRNFRSA-N |
| XLogP | 0.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|