C12H18N4O3 — CID 10801705
3,7-dimethyl-1-pentyl-9H-purine-2,6,8-trione (PubChem CID 10801705) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3,7-dimethyl-1-pentyl-9H-purine-2,6,8-trione.
| Compound Name | 3,7-dimethyl-1-pentyl-9H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 10801705 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 3,7-dimethyl-1-pentyl-9H-purine-2,6,8-trione |
| SMILES | CCCCCn1c(=O)c2c([nH]c(=O)n2C)n(C)c1=O |
| InChI | InChI=1S/C12H18N4O3/c1-4-5-6-7-16-10(17)8-9(15(3)12(16)19)13-11(18)14(8)2/h4-7H2,1-3H3,(H,13,18) |
| InChIKey | WSRBLZYCMIOGES-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|