About [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate
[7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate (PubChem CID 10801720) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate.
Molecular Properties
| Compound Name | [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate |
| PubChem CID | 10801720 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate |
| SMILES | CC(=O)OCCCCCCC(=O)c1cn(C)c(C)n1 |
| InChI | InChI=1S/C14H22N2O3/c1-11-15-13(10-16(11)3)14(18)8-6-4-5-7-9-19-12(2)17/h10H,4-9H2,1-3H3 |
| InChIKey | XVNQDRMGXNWIJL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate?
The IUPAC name of [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate (CID 10801720) is [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate.
What is the SMILES notation for [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate?
The canonical SMILES for [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate is CC(=O)OCCCCCCC(=O)c1cn(C)c(C)n1.
What is the InChIKey of [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate?
The InChIKey is XVNQDRMGXNWIJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-11-15-13(10-16(11)3)14(18)8-6-4-5-7-9-19-12(2)17/h10H,4-9H2,1-3H3.
What are the key properties of [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate?
[7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate has a molecular weight of 266.34 g/mol, XLogP of 2.42, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(1,2-dimethylimidazol-4-yl)-7-oxoheptyl] acetate is sourced from PubChem (CID 10801720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).