C14H22O5 — CID 10801983
methyl 2-[(8R,9R)-9-[(E)-4-hydroxybut-2-enyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate (PubChem CID 10801983) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is methyl 2-[(8R,9R)-9-[(E)-4-hydroxybut-2-enyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate.
| Compound Name | methyl 2-[(8R,9R)-9-[(E)-4-hydroxybut-2-enyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate |
|---|---|
| PubChem CID | 10801983 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | methyl 2-[(8R,9R)-9-[(E)-4-hydroxybut-2-enyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate |
| SMILES | COC(=O)C[C@H]1CCC2(OCCO2)[C@@H]1C/C=C/CO |
| InChI | InChI=1S/C14H22O5/c1-17-13(16)10-11-5-6-14(18-8-9-19-14)12(11)4-2-3-7-15/h2-3,11-12,15H,4-10H2,1H3/b3-2+/t11-,12-/m1/s1 |
| InChIKey | ZWPYOSRBQQBGPU-JGLYPNHGSA-N |
| XLogP | 1.26 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|