C15H26O4 — CID 10801998
(1S,2S,3S,5R,6R,8R,12R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-3,8,12-triol (PubChem CID 10801998) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S,2S,3S,5R,6R,8R,12R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-3,8,12-triol.
| Compound Name | (1S,2S,3S,5R,6R,8R,12R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-3,8,12-triol |
|---|---|
| PubChem CID | 10801998 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (1S,2S,3S,5R,6R,8R,12R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-3,8,12-triol |
| SMILES | C[C@@H]1C[C@H](O)[C@@H]2[C@@H]1C[C@@]1(O)[C@H](O)C[C@]2(C)OC1(C)C |
| InChI | InChI=1S/C15H26O4/c1-8-5-10(16)12-9(8)6-15(18)11(17)7-14(12,4)19-13(15,2)3/h8-12,16-18H,5-7H2,1-4H3/t8-,9-,10+,11-,12+,14+,15-/m1/s1 |
| InChIKey | IHSGXDAKFOFQCW-WWHMTQAXSA-N |
| XLogP | 1.07 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |