C12H16O7 — CID 10802095
2-O-[(1S,2R,3S)-2-[(1S)-1-hydroxybut-3-enyl]-3-methoxycarbonylcyclopropyl] 1-O-methyl oxalate (PubChem CID 10802095) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is 2-O-[(1S,2R,3S)-2-[(1S)-1-hydroxybut-3-enyl]-3-methoxycarbonylcyclopropyl] 1-O-methyl oxalate.
| Compound Name | 2-O-[(1S,2R,3S)-2-[(1S)-1-hydroxybut-3-enyl]-3-methoxycarbonylcyclopropyl] 1-O-methyl oxalate |
|---|---|
| PubChem CID | 10802095 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-O-[(1S,2R,3S)-2-[(1S)-1-hydroxybut-3-enyl]-3-methoxycarbonylcyclopropyl] 1-O-methyl oxalate |
| SMILES | C=CC[C@H](O)[C@@H]1[C@H](OC(=O)C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C12H16O7/c1-4-5-6(13)7-8(10(14)17-2)9(7)19-12(16)11(15)18-3/h4,6-9,13H,1,5H2,2-3H3/t6-,7-,8-,9-/m0/s1 |
| InChIKey | FRHHQOQZCKYLIN-JBDRJPRFSA-N |
| XLogP | -0.57 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|