About 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one
3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one (PubChem CID 10802225) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one.
Molecular Properties
| Compound Name | 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one |
| PubChem CID | 10802225 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one |
| SMILES | CC(=O)C1=C(C)C(C)(OCCc2ccccc2)NC1=O |
| InChI | InChI=1S/C16H19NO3/c1-11-14(12(2)18)15(19)17-16(11,3)20-10-9-13-7-5-4-6-8-13/h4-8H,9-10H2,1-3H3,(H,17,19) |
| InChIKey | AWHRFAJWQNYEDR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one?
The IUPAC name of 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one (CID 10802225) is 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one.
What is the SMILES notation for 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one?
The canonical SMILES for 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one is CC(=O)C1=C(C)C(C)(OCCc2ccccc2)NC1=O.
What is the InChIKey of 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one?
The InChIKey is AWHRFAJWQNYEDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-11-14(12(2)18)15(19)17-16(11,3)20-10-9-13-7-5-4-6-8-13/h4-8H,9-10H2,1-3H3,(H,17,19).
What are the key properties of 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one?
3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one has a molecular weight of 273.33 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-4,5-dimethyl-5-(2-phenylethoxy)-1H-pyrrol-2-one is sourced from PubChem (CID 10802225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).