C16H11N3O2 — CID 10802469
6,7-dihydroquinazolino[3,2-a][1,4]benzodiazepine-5,13-dione (PubChem CID 10802469) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is 6,7-dihydroquinazolino[3,2-a][1,4]benzodiazepine-5,13-dione.
| Compound Name | 6,7-dihydroquinazolino[3,2-a][1,4]benzodiazepine-5,13-dione |
|---|---|
| PubChem CID | 10802469 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 6,7-dihydroquinazolino[3,2-a][1,4]benzodiazepine-5,13-dione |
| SMILES | O=C1NCc2nc3ccccc3c(=O)n2-c2ccccc21 |
| InChI | InChI=1S/C16H11N3O2/c20-15-11-6-2-4-8-13(11)19-14(9-17-15)18-12-7-3-1-5-10(12)16(19)21/h1-8H,9H2,(H,17,20) |
| InChIKey | NGYKOTTXJAPLPC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |