C12H22O5S — CID 10802570
[(Z,3R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-3-yl] methanesulfonate (PubChem CID 10802570) has the molecular formula C12H22O5S and a molecular weight of 278.37 g/mol. Its IUPAC name is [(Z,3R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-3-yl] methanesulfonate.
| Compound Name | [(Z,3R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 10802570 |
| Molecular Formula | C12H22O5S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | [(Z,3R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-5-en-3-yl] methanesulfonate |
| SMILES | CC[C@H](C/C=C\[C@H]1COC(C)(C)O1)OS(C)(=O)=O |
| InChI | InChI=1S/C12H22O5S/c1-5-10(17-18(4,13)14)7-6-8-11-9-15-12(2,3)16-11/h6,8,10-11H,5,7,9H2,1-4H3/b8-6-/t10-,11+/m1/s1 |
| InChIKey | UDBBYNHIEBIENN-XZZRAGQBSA-N |
| XLogP | 1.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|