About 1-(3-aminopropylamino)anthracene-9,10-dione
1-(3-aminopropylamino)anthracene-9,10-dione (PubChem CID 10802699) has the molecular formula C17H16N2O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-(3-aminopropylamino)anthracene-9,10-dione.
Molecular Properties
| Compound Name | 1-(3-aminopropylamino)anthracene-9,10-dione |
| PubChem CID | 10802699 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-(3-aminopropylamino)anthracene-9,10-dione |
| SMILES | NCCCNc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H16N2O2/c18-9-4-10-19-14-8-3-7-13-15(14)17(21)12-6-2-1-5-11(12)16(13)20/h1-3,5-8,19H,4,9-10,18H2 |
| InChIKey | MLVKRZHLEQPZTP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-aminopropylamino)anthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-aminopropylamino)anthracene-9,10-dione?
The IUPAC name of 1-(3-aminopropylamino)anthracene-9,10-dione (CID 10802699) is 1-(3-aminopropylamino)anthracene-9,10-dione.
What is the SMILES notation for 1-(3-aminopropylamino)anthracene-9,10-dione?
The canonical SMILES for 1-(3-aminopropylamino)anthracene-9,10-dione is NCCCNc1cccc2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 1-(3-aminopropylamino)anthracene-9,10-dione?
The InChIKey is MLVKRZHLEQPZTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2/c18-9-4-10-19-14-8-3-7-13-15(14)17(21)12-6-2-1-5-11(12)16(13)20/h1-3,5-8,19H,4,9-10,18H2.
What are the key properties of 1-(3-aminopropylamino)anthracene-9,10-dione?
1-(3-aminopropylamino)anthracene-9,10-dione has a molecular weight of 280.33 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-aminopropylamino)anthracene-9,10-dione is sourced from PubChem (CID 10802699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).