About 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione
2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione (PubChem CID 10802708) has the molecular formula C17H12O2S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione.
Molecular Properties
| Compound Name | 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione |
| PubChem CID | 10802708 |
| Molecular Formula | C17H12O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione |
| SMILES | Cc1cc2ccc3c(ccc4c(C)cc(=S)oc43)c2o1 |
| InChI | InChI=1S/C17H12O2S/c1-9-7-15(20)19-17-12(9)5-6-13-14(17)4-3-11-8-10(2)18-16(11)13/h3-8H,1-2H3 |
| InChIKey | SDWXGVPVMZODQP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione?
The IUPAC name of 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione (CID 10802708) is 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione.
What is the SMILES notation for 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione?
The canonical SMILES for 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione is Cc1cc2ccc3c(ccc4c(C)cc(=S)oc43)c2o1.
What is the InChIKey of 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione?
The InChIKey is SDWXGVPVMZODQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O2S/c1-9-7-15(20)19-17-12(9)5-6-13-14(17)4-3-11-8-10(2)18-16(11)13/h3-8H,1-2H3.
What are the key properties of 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione?
2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione has a molecular weight of 280.35 g/mol, XLogP of 5.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-[1]benzofuro[7,6-h]chromene-8-thione is sourced from PubChem (CID 10802708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).