About [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea
[(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea (PubChem CID 10802917) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea.
Molecular Properties
| Compound Name | [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea |
| PubChem CID | 10802917 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea |
| SMILES | Cc1ccc(Oc2ccc(/C=N/NC(N)=O)cc2)cc1C |
| InChI | InChI=1S/C16H17N3O2/c1-11-3-6-15(9-12(11)2)21-14-7-4-13(5-8-14)10-18-19-16(17)20/h3-10H,1-2H3,(H3,17,19,20)/b18-10+ |
| InChIKey | KXWLCZMCPCGOBD-VCHYOVAHSA-N |
| XLogP | 3.10 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea?
The IUPAC name of [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea (CID 10802917) is [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea.
What is the SMILES notation for [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea?
The canonical SMILES for [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea is Cc1ccc(Oc2ccc(/C=N/NC(N)=O)cc2)cc1C.
What is the InChIKey of [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea?
The InChIKey is KXWLCZMCPCGOBD-VCHYOVAHSA-N. The full InChI is InChI=1S/C16H17N3O2/c1-11-3-6-15(9-12(11)2)21-14-7-4-13(5-8-14)10-18-19-16(17)20/h3-10H,1-2H3,(H3,17,19,20)/b18-10+.
What are the key properties of [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea?
[(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea has a molecular weight of 283.33 g/mol, XLogP of 3.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[4-(3,4-dimethylphenoxy)phenyl]methylideneamino]urea is sourced from PubChem (CID 10802917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).