C14H19N4O+ — CID 10803
2-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-methylpyridin-1-ium-3-yl]ethanol (PubChem CID 10803) has the molecular formula C14H19N4O+ and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-methylpyridin-1-ium-3-yl]ethanol.
| Compound Name | 2-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-methylpyridin-1-ium-3-yl]ethanol |
|---|---|
| PubChem CID | 10803 |
| Molecular Formula | C14H19N4O+ |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2-[1-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-methylpyridin-1-ium-3-yl]ethanol |
| SMILES | Cc1ncc(C[n+]2cccc(CCO)c2C)c(N)n1 |
| InChI | InChI=1S/C14H19N4O/c1-10-12(5-7-19)4-3-6-18(10)9-13-8-16-11(2)17-14(13)15/h3-4,6,8,19H,5,7,9H2,1-2H3,(H2,15,16,17)/q+1 |
| InChIKey | PZWYDZMWPANLMB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 75.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|