About 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one
2-(3-bromopropyl)-4,5-dichloropyridazin-3-one (PubChem CID 10803086) has the molecular formula C7H7BrCl2N2O
and a molecular weight of 285.96 g/mol. Its IUPAC name is 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one.
Molecular Properties
| Compound Name | 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one |
| PubChem CID | 10803086 |
| Molecular Formula | C7H7BrCl2N2O |
| Molecular Weight | 285.96 g/mol |
| Exact Mass | 283.91 |
| IUPAC Name | 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CCCBr |
| InChI | InChI=1S/C7H7BrCl2N2O/c8-2-1-3-12-7(13)6(10)5(9)4-11-12/h4H,1-3H2 |
| InChIKey | LZFLPNHPPDXOFL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.96 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one?
The IUPAC name of 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one (CID 10803086) is 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one.
What is the SMILES notation for 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one?
The canonical SMILES for 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one is O=c1c(Cl)c(Cl)cnn1CCCBr.
What is the InChIKey of 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one?
The InChIKey is LZFLPNHPPDXOFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrCl2N2O/c8-2-1-3-12-7(13)6(10)5(9)4-11-12/h4H,1-3H2.
What are the key properties of 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one?
2-(3-bromopropyl)-4,5-dichloropyridazin-3-one has a molecular weight of 285.96 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromopropyl)-4,5-dichloropyridazin-3-one is sourced from PubChem (CID 10803086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).