C19H26O2 — CID 10803156
(8E,10E,12E,14R)-1,14-dimethoxyheptadeca-8,10,12-trien-4,6-diyne (PubChem CID 10803156) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (8E,10E,12E,14R)-1,14-dimethoxyheptadeca-8,10,12-trien-4,6-diyne.
| Compound Name | (8E,10E,12E,14R)-1,14-dimethoxyheptadeca-8,10,12-trien-4,6-diyne |
|---|---|
| PubChem CID | 10803156 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (8E,10E,12E,14R)-1,14-dimethoxyheptadeca-8,10,12-trien-4,6-diyne |
| SMILES | CCC[C@H](/C=C/C=C/C=C/C#CC#CCCCOC)OC |
| InChI | InChI=1S/C19H26O2/c1-4-16-19(21-3)17-14-12-10-8-6-5-7-9-11-13-15-18-20-2/h6,8,10,12,14,17,19H,4,13,15-16,18H2,1-3H3/b8-6+,12-10+,17-14+/t19-/m1/s1 |
| InChIKey | AFTAXRDKAALBHW-HRFDSNEHSA-N |
| XLogP | 3.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|