C20H30O — CID 10803162
1-methoxy-3-[(1E,2R)-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]propan-2-yl]benzene (PubChem CID 10803162) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-methoxy-3-[(1E,2R)-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]propan-2-yl]benzene.
| Compound Name | 1-methoxy-3-[(1E,2R)-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]propan-2-yl]benzene |
|---|---|
| PubChem CID | 10803162 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 1-methoxy-3-[(1E,2R)-1-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]propan-2-yl]benzene |
| SMILES | COc1cccc([C@H](C)/C=C2\C[C@H](C)CC[C@H]2C(C)C)c1 |
| InChI | InChI=1S/C20H30O/c1-14(2)20-10-9-15(3)11-18(20)12-16(4)17-7-6-8-19(13-17)21-5/h6-8,12-16,20H,9-11H2,1-5H3/b18-12+/t15-,16-,20+/m1/s1 |
| InChIKey | YHKAECPDVKXGSW-ZQKHLXFTSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|